ChemNet > CAS > 43088-67-1 4-chloro-5-methylthieno[2,3-d]pyrimidine
43088-67-1 4-chloro-5-methylthieno[2,3-d]pyrimidine
| Ürün Adı |
4-chloro-5-methylthieno[2,3-d]pyrimidine |
| Moleküler Formülü |
C7H5ClN2S |
| Molekül Ağırlığı |
184.646 |
| InChI |
InChI=1/C7H5ClN2S/c1-4-2-11-7-5(4)6(8)9-3-10-7/h2-3H,1H3 |
| CAS kayıt numarası |
43088-67-1 |
| Moleküler Yapısı |
![43088-67-1 4-chloro-5-methylthieno[2,3-d]pyrimidine](https://images-a.chemnet.com/suppliers/chembase/172/17212.gif)
|
| Yoğunluk |
1.445g/cm3 |
| Ergime noktası |
138℃ |
| Kaynama noktası |
301.3°C at 760 mmHg |
| Kırılma indisi |
1.682 |
| Alevlenme noktası |
136°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
